C18H22F3NO2 — CID 56790869
1-[4-(2,4,6-trifluorobenzoyl)piperidin-1-yl]hexan-1-one (PubChem CID 56790869) has the molecular formula C18H22F3NO2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-[4-(2,4,6-trifluorobenzoyl)piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[4-(2,4,6-trifluorobenzoyl)piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 56790869 |
| Molecular Formula | C18H22F3NO2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-[4-(2,4,6-trifluorobenzoyl)piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCC(C(=O)c2c(F)cc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H22F3NO2/c1-2-3-4-5-16(23)22-8-6-12(7-9-22)18(24)17-14(20)10-13(19)11-15(17)21/h10-12H,2-9H2,1H3 |
| InChIKey | LYAIKWMZJWZVCC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|