C16H14N4O — CID 166197233
7,8-dihydro-5H-1,6-naphthyridin-6-yl(1H-indazol-5-yl)methanone (PubChem CID 166197233) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is 7,8-dihydro-5H-1,6-naphthyridin-6-yl(1H-indazol-5-yl)methanone.
| Compound Name | 7,8-dihydro-5H-1,6-naphthyridin-6-yl(1H-indazol-5-yl)methanone |
|---|---|
| PubChem CID | 166197233 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 7,8-dihydro-5H-1,6-naphthyridin-6-yl(1H-indazol-5-yl)methanone |
| SMILES | O=C(c1ccc2[nH]ncc2c1)N1CCc2ncccc2C1 |
| InChI | InChI=1S/C16H14N4O/c21-16(11-3-4-15-13(8-11)9-18-19-15)20-7-5-14-12(10-20)2-1-6-17-14/h1-4,6,8-9H,5,7,10H2,(H,18,19) |
| InChIKey | PJEWECMAUZUJLU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |