C13H11IN2OS — CID 79694045
7,8-dihydro-5H-1,6-naphthyridin-6-yl-(5-iodothiophen-3-yl)methanone (PubChem CID 79694045) has the molecular formula C13H11IN2OS and a molecular weight of 370.22 g/mol. Its IUPAC name is 7,8-dihydro-5H-1,6-naphthyridin-6-yl-(5-iodothiophen-3-yl)methanone.
| Compound Name | 7,8-dihydro-5H-1,6-naphthyridin-6-yl-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 79694045 |
| Molecular Formula | C13H11IN2OS |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 7,8-dihydro-5H-1,6-naphthyridin-6-yl-(5-iodothiophen-3-yl)methanone |
| SMILES | O=C(c1csc(I)c1)N1CCc2ncccc2C1 |
| InChI | InChI=1S/C13H11IN2OS/c14-12-6-10(8-18-12)13(17)16-5-3-11-9(7-16)2-1-4-15-11/h1-2,4,6,8H,3,5,7H2 |
| InChIKey | VUUVEXYAQKWOPL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|