C15H12BrIN2O — CID 103830275
(5-bromo-2-iodophenyl)-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone (PubChem CID 103830275) has the molecular formula C15H12BrIN2O and a molecular weight of 443.08 g/mol. Its IUPAC name is (5-bromo-2-iodophenyl)-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone.
| Compound Name | (5-bromo-2-iodophenyl)-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
|---|---|
| PubChem CID | 103830275 |
| Molecular Formula | C15H12BrIN2O |
| Molecular Weight | 443.08 g/mol |
| Exact Mass | 441.92 |
| IUPAC Name | (5-bromo-2-iodophenyl)-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
| SMILES | O=C(c1cc(Br)ccc1I)N1CCc2ncccc2C1 |
| InChI | InChI=1S/C15H12BrIN2O/c16-11-3-4-13(17)12(8-11)15(20)19-7-5-14-10(9-19)2-1-6-18-14/h1-4,6,8H,5,7,9H2 |
| InChIKey | OFIYWUMBOKEPFW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.08 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|