C25H19ClF3N3O — CID 69004760
[4-chloro-3-(2-pyridin-2-ylethynyl)phenyl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 69004760) has the molecular formula C25H19ClF3N3O and a molecular weight of 469.89 g/mol. Its IUPAC name is [4-chloro-3-(2-pyridin-2-ylethynyl)phenyl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [4-chloro-3-(2-pyridin-2-ylethynyl)phenyl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 69004760 |
| Molecular Formula | C25H19ClF3N3O |
| Molecular Weight | 469.89 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | [4-chloro-3-(2-pyridin-2-ylethynyl)phenyl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(C#Cc2ccccn2)c1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H19ClF3N3O/c26-23-10-8-19(16-18(23)7-9-21-5-1-2-11-30-21)24(33)32-14-12-31(13-15-32)22-6-3-4-20(17-22)25(27,28)29/h1-6,8,10-11,16-17H,12-15H2 |
| InChIKey | AOLFCUAPPLLXCG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|