C23H17BrN2O2 — CID 46945590
(5-bromo-1,3-dihydroisoindol-2-yl)-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone (PubChem CID 46945590) has the molecular formula C23H17BrN2O2 and a molecular weight of 433.31 g/mol. Its IUPAC name is (5-bromo-1,3-dihydroisoindol-2-yl)-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone.
| Compound Name | (5-bromo-1,3-dihydroisoindol-2-yl)-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 46945590 |
| Molecular Formula | C23H17BrN2O2 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | (5-bromo-1,3-dihydroisoindol-2-yl)-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
| SMILES | COc1ccc(C(=O)N2Cc3ccc(Br)cc3C2)cc1C#Cc1ccccn1 |
| InChI | InChI=1S/C23H17BrN2O2/c1-28-22-10-7-17(12-16(22)6-9-21-4-2-3-11-25-21)23(27)26-14-18-5-8-20(24)13-19(18)15-26/h2-5,7-8,10-13H,14-15H2,1H3 |
| InChIKey | RDRLRIQBEJMCQC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|