C26H22ClN3O3 — CID 69001499
1-[(3-chlorophenyl)methyl]-4-[4-methoxy-3-(2-pyridin-2-ylethynyl)benzoyl]piperazin-2-one (PubChem CID 69001499) has the molecular formula C26H22ClN3O3 and a molecular weight of 459.93 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-[4-methoxy-3-(2-pyridin-2-ylethynyl)benzoyl]piperazin-2-one.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-[4-methoxy-3-(2-pyridin-2-ylethynyl)benzoyl]piperazin-2-one |
|---|---|
| PubChem CID | 69001499 |
| Molecular Formula | C26H22ClN3O3 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-[4-methoxy-3-(2-pyridin-2-ylethynyl)benzoyl]piperazin-2-one |
| SMILES | COc1ccc(C(=O)N2CCN(Cc3cccc(Cl)c3)C(=O)C2)cc1C#Cc1ccccn1 |
| InChI | InChI=1S/C26H22ClN3O3/c1-33-24-11-9-21(16-20(24)8-10-23-7-2-3-12-28-23)26(32)30-14-13-29(25(31)18-30)17-19-5-4-6-22(27)15-19/h2-7,9,11-12,15-16H,13-14,17-18H2,1H3 |
| InChIKey | WDHGNAYSWATXGC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|