C25H21ClN2O2 — CID 46946792
(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-ethoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone (PubChem CID 46946792) has the molecular formula C25H21ClN2O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is (5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-ethoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone.
| Compound Name | (5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-ethoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 46946792 |
| Molecular Formula | C25H21ClN2O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-ethoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CCc3c(Cl)cccc3C2)cc1C#Cc1ccccn1 |
| InChI | InChI=1S/C25H21ClN2O2/c1-2-30-24-12-10-19(16-18(24)9-11-21-7-3-4-14-27-21)25(29)28-15-13-22-20(17-28)6-5-8-23(22)26/h3-8,10,12,14,16H,2,13,15,17H2,1H3 |
| InChIKey | MGYNDPTYZBWGEU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|