C14H16F3N3O3 — CID 2741588
4-oxo-4-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butanoic acid (PubChem CID 2741588) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 4-oxo-4-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butanoic acid.
| Compound Name | 4-oxo-4-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 2741588 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-oxo-4-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butanoic acid |
| SMILES | O=C(O)CCC(=O)N1CCN(c2ncccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H16F3N3O3/c15-14(16,17)10-2-1-5-18-13(10)20-8-6-19(7-9-20)11(21)3-4-12(22)23/h1-2,5H,3-4,6-9H2,(H,22,23) |
| InChIKey | QJMNEYFWSOIYCD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |