C22H22F10N4O — CID 160959250
(2R)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide;methane (PubChem CID 160959250) has the molecular formula C22H22F10N4O and a molecular weight of 548.43 g/mol. Its IUPAC name is (2R)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide;methane.
| Compound Name | (2R)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide;methane |
|---|---|
| PubChem CID | 160959250 |
| Molecular Formula | C22H22F10N4O |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | (2R)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide;methane |
| SMILES | C.C[C@@H]1CN(c2ncccc2C(F)(F)F)CCN1C(=O)Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F10N4O.CH4/c1-12-11-34(16-15(19(23,24)25)3-2-8-32-16)9-10-35(12)17(36)33-14-6-4-13(5-7-14)18(22,20(26,27)28)21(29,30)31;/h2-8,12H,9-11H2,1H3,(H,33,36);1H4/t12-;/m1./s1 |
| InChIKey | SWUMCIVCSHXMCV-UTONKHPSSA-N |
| XLogP | 6.77 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |