C21H27F3N4OSi — CID 51349069
(2R)-2-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]-N-(3-trimethylsilylphenyl)piperazine-1-carboxamide (PubChem CID 51349069) has the molecular formula C21H27F3N4OSi and a molecular weight of 436.55 g/mol. Its IUPAC name is (2R)-2-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]-N-(3-trimethylsilylphenyl)piperazine-1-carboxamide.
| Compound Name | (2R)-2-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]-N-(3-trimethylsilylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 51349069 |
| Molecular Formula | C21H27F3N4OSi |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2R)-2-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]-N-(3-trimethylsilylphenyl)piperazine-1-carboxamide |
| SMILES | C[C@@H]1CN(c2ncccc2C(F)(F)F)CCN1C(=O)Nc1cccc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C21H27F3N4OSi/c1-15-14-27(19-18(21(22,23)24)9-6-10-25-19)11-12-28(15)20(29)26-16-7-5-8-17(13-16)30(2,3)4/h5-10,13,15H,11-12,14H2,1-4H3,(H,26,29)/t15-/m1/s1 |
| InChIKey | CYPYLXYMKFQQLY-OAHLLOKOSA-N |
| XLogP | 4.39 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|