C25H23N5O — CID 2951839
N-phenyl-4-(4-phenylphthalazin-1-yl)piperazine-1-carboxamide (PubChem CID 2951839) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is N-phenyl-4-(4-phenylphthalazin-1-yl)piperazine-1-carboxamide.
| Compound Name | N-phenyl-4-(4-phenylphthalazin-1-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 2951839 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-phenyl-4-(4-phenylphthalazin-1-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCN(c2nnc(-c3ccccc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C25H23N5O/c31-25(26-20-11-5-2-6-12-20)30-17-15-29(16-18-30)24-22-14-8-7-13-21(22)23(27-28-24)19-9-3-1-4-10-19/h1-14H,15-18H2,(H,26,31) |
| InChIKey | VBFOWBUNUZEIRT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |