C14H17ClN3O2S+ — CID 6934369
7-chloro-4-(4-methylsulfonylpiperazin-1-yl)quinolin-1-ium (PubChem CID 6934369) has the molecular formula C14H17ClN3O2S+ and a molecular weight of 326.83 g/mol. Its IUPAC name is 7-chloro-4-(4-methylsulfonylpiperazin-1-yl)quinolin-1-ium.
| Compound Name | 7-chloro-4-(4-methylsulfonylpiperazin-1-yl)quinolin-1-ium |
|---|---|
| PubChem CID | 6934369 |
| Molecular Formula | C14H17ClN3O2S+ |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 7-chloro-4-(4-methylsulfonylpiperazin-1-yl)quinolin-1-ium |
| SMILES | CS(=O)(=O)N1CCN(c2cc[nH+]c3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C14H16ClN3O2S/c1-21(19,20)18-8-6-17(7-9-18)14-4-5-16-13-10-11(15)2-3-12(13)14/h2-5,10H,6-9H2,1H3/p+1 |
| InChIKey | IYTUJCPWVORWDU-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 54.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |