C15H18ClN2O+ — CID 8000509
(2R,6S)-4-(7-chloroquinolin-1-ium-4-yl)-2,6-dimethylmorpholine (PubChem CID 8000509) has the molecular formula C15H18ClN2O+ and a molecular weight of 277.78 g/mol. Its IUPAC name is (2R,6S)-4-(7-chloroquinolin-1-ium-4-yl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-(7-chloroquinolin-1-ium-4-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 8000509 |
| Molecular Formula | C15H18ClN2O+ |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2R,6S)-4-(7-chloroquinolin-1-ium-4-yl)-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(c2cc[nH+]c3cc(Cl)ccc23)C[C@H](C)O1 |
| InChI | InChI=1S/C15H17ClN2O/c1-10-8-18(9-11(2)19-10)15-5-6-17-14-7-12(16)3-4-13(14)15/h3-7,10-11H,8-9H2,1-2H3/p+1/t10-,11+ |
| InChIKey | KRWMDOOKRDVCKN-PHIMTYICSA-O |
| XLogP | 2.92 |
| TPSA | 26.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |