C25H25ClF3N3O5 — CID 67255850
methyl (2S,5R)-5-(2-chlorophenyl)-1-[1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 67255850) has the molecular formula C25H25ClF3N3O5 and a molecular weight of 539.94 g/mol. Its IUPAC name is methyl (2S,5R)-5-(2-chlorophenyl)-1-[1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,5R)-5-(2-chlorophenyl)-1-[1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67255850 |
| Molecular Formula | C25H25ClF3N3O5 |
| Molecular Weight | 539.94 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | methyl (2S,5R)-5-(2-chlorophenyl)-1-[1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H](c2ccccc2Cl)N1C(=O)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C25H25ClF3N3O5/c1-37-24(34)21-9-8-19(17-4-2-3-5-18(17)26)31(21)23(33)15-10-12-30(13-11-15)20-7-6-16(25(27,28)29)14-22(20)32(35)36/h2-7,14-15,19,21H,8-13H2,1H3/t19-,21+/m1/s1 |
| InChIKey | IZRPHNQBDZIGON-CTNGQTDRSA-N |
| XLogP | 5.39 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.94 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|