C24H26ClN3O5 — CID 53258463
(2S,5R)-5-(2-chlorophenyl)-1-[1-(4-methyl-2-nitrophenyl)piperidine-4-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 53258463) has the molecular formula C24H26ClN3O5 and a molecular weight of 471.94 g/mol. Its IUPAC name is (2S,5R)-5-(2-chlorophenyl)-1-[1-(4-methyl-2-nitrophenyl)piperidine-4-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,5R)-5-(2-chlorophenyl)-1-[1-(4-methyl-2-nitrophenyl)piperidine-4-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 53258463 |
| Molecular Formula | C24H26ClN3O5 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (2S,5R)-5-(2-chlorophenyl)-1-[1-(4-methyl-2-nitrophenyl)piperidine-4-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(N2CCC(C(=O)N3[C@@H](c4ccccc4Cl)CC[C@H]3C(=O)O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H26ClN3O5/c1-15-6-7-20(22(14-15)28(32)33)26-12-10-16(11-13-26)23(29)27-19(8-9-21(27)24(30)31)17-4-2-3-5-18(17)25/h2-7,14,16,19,21H,8-13H2,1H3,(H,30,31)/t19-,21+/m1/s1 |
| InChIKey | AAFCMWWNQVJIOV-CTNGQTDRSA-N |
| XLogP | 4.59 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|