C26H32N4O8S — CID 4858670
[4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]-[4-(oxolan-2-ylmethoxy)phenyl]methanone (PubChem CID 4858670) has the molecular formula C26H32N4O8S and a molecular weight of 560.63 g/mol. Its IUPAC name is [4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]-[4-(oxolan-2-ylmethoxy)phenyl]methanone.
| Compound Name | [4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]-[4-(oxolan-2-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 4858670 |
| Molecular Formula | C26H32N4O8S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | [4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]-[4-(oxolan-2-ylmethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCC2CCCO2)cc1)N1CCN(c2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C26H32N4O8S/c31-26(20-3-5-21(6-4-20)38-19-22-2-1-15-37-22)28-11-9-27(10-12-28)24-8-7-23(18-25(24)30(32)33)39(34,35)29-13-16-36-17-14-29/h3-8,18,22H,1-2,9-17,19H2 |
| InChIKey | ACKCZQNJEXQCSF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 131.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|