C18H28N4O3S — CID 111059251
N'-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]morpholine-4-carboximidamide (PubChem CID 111059251) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is N'-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]morpholine-4-carboximidamide.
| Compound Name | N'-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111059251 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N'-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]morpholine-4-carboximidamide |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(C/N=C(\N)N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C18H28N4O3S/c1-15-3-2-8-22(14-15)26(23,24)17-6-4-16(5-7-17)13-20-18(19)21-9-11-25-12-10-21/h4-7,15H,2-3,8-14H2,1H3,(H2,19,20) |
| InChIKey | SYJPXPXWRYETFV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|