C16H21N5O — CID 110030402
1-cyclopropyl-2-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-1-methylguanidine (PubChem CID 110030402) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-cyclopropyl-2-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 110030402 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-cyclopropyl-2-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-1-methylguanidine |
| SMILES | COc1ccc(-n2ccc(C/N=C(\N)N(C)C3CC3)n2)cc1 |
| InChI | InChI=1S/C16H21N5O/c1-20(13-3-4-13)16(17)18-11-12-9-10-21(19-12)14-5-7-15(22-2)8-6-14/h5-10,13H,3-4,11H2,1-2H3,(H2,17,18) |
| InChIKey | YTHXKSSVBRORSB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|