C16H23N5O — CID 111073831
1,1-diethyl-2-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]guanidine (PubChem CID 111073831) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 1,1-diethyl-2-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]guanidine.
| Compound Name | 1,1-diethyl-2-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111073831 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1,1-diethyl-2-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]guanidine |
| SMILES | CCN(CC)/C(N)=N/Cc1ccn(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C16H23N5O/c1-4-20(5-2)16(17)18-12-13-10-11-21(19-13)14-6-8-15(22-3)9-7-14/h6-11H,4-5,12H2,1-3H3,(H2,17,18) |
| InChIKey | KUOHVSMRDANVMZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|