About N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide
N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 110927661) has the molecular formula C13H24IN5
and a molecular weight of 377.27 g/mol. Its IUPAC name is N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
| PubChem CID | 110927661 |
| Molecular Formula | C13H24IN5 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | Cc1n[nH]c(C)c1C/N=C(\N)N1CCC(C)CC1.I |
| InChI | InChI=1S/C13H23N5.HI/c1-9-4-6-18(7-5-9)13(14)15-8-12-10(2)16-17-11(12)3;/h9H,4-8H2,1-3H3,(H2,14,15)(H,16,17);1H |
| InChIKey | LLEZASILPSNFKZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide?
The IUPAC name of N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide (CID 110927661) is N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide.
What is the SMILES notation for N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide?
The canonical SMILES for N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide is Cc1n[nH]c(C)c1C/N=C(\N)N1CCC(C)CC1.I.
What is the InChIKey of N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide?
The InChIKey is LLEZASILPSNFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N5.HI/c1-9-4-6-18(7-5-9)13(14)15-8-12-10(2)16-17-11(12)3;/h9H,4-8H2,1-3H3,(H2,14,15)(H,16,17);1H.
What are the key properties of N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide?
N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide has a molecular weight of 377.27 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide is sourced from PubChem (CID 110927661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).