C15H20N6OS — CID 111050682
N'-[(2-methoxy-3-pyridinyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111050682) has the molecular formula C15H20N6OS and a molecular weight of 332.43 g/mol. Its IUPAC name is N'-[(2-methoxy-3-pyridinyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(2-methoxy-3-pyridinyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111050682 |
| Molecular Formula | C15H20N6OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N'-[(2-methoxy-3-pyridinyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | COc1ncccc1C/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H20N6OS/c1-22-13-12(3-2-4-17-13)11-19-14(16)20-6-8-21(9-7-20)15-18-5-10-23-15/h2-5,10H,6-9,11H2,1H3,(H2,16,19) |
| InChIKey | GHRLVCQUGBAZKT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|