C18H24IN5OS — CID 111810199
N'-[(2-prop-2-enoxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111810199) has the molecular formula C18H24IN5OS and a molecular weight of 485.40 g/mol. Its IUPAC name is N'-[(2-prop-2-enoxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(2-prop-2-enoxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111810199 |
| Molecular Formula | C18H24IN5OS |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | N'-[(2-prop-2-enoxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C=CCOc1ccccc1C/N=C(\N)N1CCN(c2nccs2)CC1.I |
| InChI | InChI=1S/C18H23N5OS.HI/c1-2-12-24-16-6-4-3-5-15(16)14-21-17(19)22-8-10-23(11-9-22)18-20-7-13-25-18;/h2-7,13H,1,8-12,14H2,(H2,19,21);1H |
| InChIKey | ROTRTLUCVZTCHF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|