C16H23N3O — CID 111810182
N'-[(2-prop-2-enoxyphenyl)methyl]piperidine-1-carboximidamide (PubChem CID 111810182) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N'-[(2-prop-2-enoxyphenyl)methyl]piperidine-1-carboximidamide.
| Compound Name | N'-[(2-prop-2-enoxyphenyl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111810182 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N'-[(2-prop-2-enoxyphenyl)methyl]piperidine-1-carboximidamide |
| SMILES | C=CCOc1ccccc1C/N=C(\N)N1CCCCC1 |
| InChI | InChI=1S/C16H23N3O/c1-2-12-20-15-9-5-4-8-14(15)13-18-16(17)19-10-6-3-7-11-19/h2,4-5,8-9H,1,3,6-7,10-13H2,(H2,17,18) |
| InChIKey | XPNFIPXDEQKKHW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|