C17H26IN3O — CID 111816443
N'-[(2-cyclobutyloxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111816443) has the molecular formula C17H26IN3O and a molecular weight of 415.32 g/mol. Its IUPAC name is N'-[(2-cyclobutyloxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(2-cyclobutyloxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111816443 |
| Molecular Formula | C17H26IN3O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N'-[(2-cyclobutyloxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccc1OC1CCC1)N1CCCCC1 |
| InChI | InChI=1S/C17H25N3O.HI/c18-17(20-11-4-1-5-12-20)19-13-14-7-2-3-10-16(14)21-15-8-6-9-15;/h2-3,7,10,15H,1,4-6,8-9,11-13H2,(H2,18,19);1H |
| InChIKey | QIICDUFWDPFCJQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|