C16H20F3IN6OS — CID 111050425
4-(1,3-thiazol-2-yl)-N'-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111050425) has the molecular formula C16H20F3IN6OS and a molecular weight of 528.34 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)-N'-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(1,3-thiazol-2-yl)-N'-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111050425 |
| Molecular Formula | C16H20F3IN6OS |
| Molecular Weight | 528.34 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)-N'-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccnc1OCC(F)(F)F)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H19F3N6OS.HI/c17-16(18,19)11-26-13-12(2-1-3-21-13)10-23-14(20)24-5-7-25(8-6-24)15-22-4-9-27-15;/h1-4,9H,5-8,10-11H2,(H2,20,23);1H |
| InChIKey | PVNCJTMMIOXIMD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|