C17H21FIN5O — CID 75468371
N'-[(3-fluoro-4-hydroxyphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 75468371) has the molecular formula C17H21FIN5O and a molecular weight of 457.29 g/mol. Its IUPAC name is N'-[(3-fluoro-4-hydroxyphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(3-fluoro-4-hydroxyphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 75468371 |
| Molecular Formula | C17H21FIN5O |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N'-[(3-fluoro-4-hydroxyphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(O)c(F)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H20FN5O.HI/c18-14-11-13(4-5-15(14)24)12-21-17(19)23-9-7-22(8-10-23)16-3-1-2-6-20-16;/h1-6,11,24H,7-10,12H2,(H2,19,21);1H |
| InChIKey | NEHLJPHKUAVDPP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|