C22H26FN7 — CID 111219795
N-ethyl-N'-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111219795) has the molecular formula C22H26FN7 and a molecular weight of 407.50 g/mol. Its IUPAC name is N-ethyl-N'-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111219795 |
| Molecular Formula | C22H26FN7 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-ethyl-N'-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)c(F)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H26FN7/c1-2-25-22(29-13-11-28(12-14-29)21-5-3-4-8-26-21)27-16-18-6-7-20(19(23)15-18)30-10-9-24-17-30/h3-10,15,17H,2,11-14,16H2,1H3,(H,25,27) |
| InChIKey | VUDJYJGZUSVDBD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|