C22H28FIN8 — CID 111207819
N-ethyl-N'-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111207819) has the molecular formula C22H28FIN8 and a molecular weight of 550.42 g/mol. Its IUPAC name is N-ethyl-N'-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111207819 |
| Molecular Formula | C22H28FIN8 |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | N-ethyl-N'-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)c(F)c1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C22H27FN8.HI/c1-3-24-21(29-11-13-30(14-12-29)22-26-7-4-8-27-22)28-16-18-5-6-20(19(23)15-18)31-10-9-25-17(31)2;/h4-10,15H,3,11-14,16H2,1-2H3,(H,24,28);1H |
| InChIKey | DLABZPWDQLQTAZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|