C18H22FN5O2S — CID 111069998
N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111069998) has the molecular formula C18H22FN5O2S and a molecular weight of 391.47 g/mol. Its IUPAC name is N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111069998 |
| Molecular Formula | C18H22FN5O2S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCc1cc(F)cc2c1OCOC2)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C18H22FN5O2S/c19-15-9-13(16-14(10-15)11-25-12-26-16)1-2-21-17(20)23-4-6-24(7-5-23)18-22-3-8-27-18/h3,8-10H,1-2,4-7,11-12H2,(H2,20,21) |
| InChIKey | INHFSDYBEXGKOO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|