C21H24ClFN4O2 — CID 111069990
4-(4-chlorophenyl)-N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111069990) has the molecular formula C21H24ClFN4O2 and a molecular weight of 418.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111069990 |
| Molecular Formula | C21H24ClFN4O2 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCc1cc(F)cc2c1OCOC2)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H24ClFN4O2/c22-17-1-3-19(4-2-17)26-7-9-27(10-8-26)21(24)25-6-5-15-11-18(23)12-16-13-28-14-29-20(15)16/h1-4,11-12H,5-10,13-14H2,(H2,24,25) |
| InChIKey | JUZKTLOJHXUOLO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|