C14H19FIN3O2S — CID 119121394
N'-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 119121394) has the molecular formula C14H19FIN3O2S and a molecular weight of 439.29 g/mol. Its IUPAC name is N'-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119121394 |
| Molecular Formula | C14H19FIN3O2S |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | N'-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cc(F)cc2c1OCOC2)N1CCSCC1 |
| InChI | InChI=1S/C14H18FN3O2S.HI/c15-12-5-10(13-11(6-12)8-19-9-20-13)7-17-14(16)18-1-3-21-4-2-18;/h5-6H,1-4,7-9H2,(H2,16,17);1H |
| InChIKey | PTQHDCFZWMRKGM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|