C19H28FIN4O2 — CID 119150322
1-(1-cyclopropylpyrrolidin-3-yl)-3-ethyl-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide (PubChem CID 119150322) has the molecular formula C19H28FIN4O2 and a molecular weight of 490.36 g/mol. Its IUPAC name is 1-(1-cyclopropylpyrrolidin-3-yl)-3-ethyl-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1-cyclopropylpyrrolidin-3-yl)-3-ethyl-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119150322 |
| Molecular Formula | C19H28FIN4O2 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 1-(1-cyclopropylpyrrolidin-3-yl)-3-ethyl-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)cc2c1OCOC2)NC1CCN(C2CC2)C1.I |
| InChI | InChI=1S/C19H27FN4O2.HI/c1-2-21-19(23-16-5-6-24(10-16)17-3-4-17)22-9-13-7-15(20)8-14-11-25-12-26-18(13)14;/h7-8,16-17H,2-6,9-12H2,1H3,(H2,21,22,23);1H |
| InChIKey | KGDYBUWRLOWLEO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|