C20H30ClIN4O2 — CID 119150112
2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-(1-cyclopropylpyrrolidin-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 119150112) has the molecular formula C20H30ClIN4O2 and a molecular weight of 520.84 g/mol. Its IUPAC name is 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-(1-cyclopropylpyrrolidin-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-(1-cyclopropylpyrrolidin-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119150112 |
| Molecular Formula | C20H30ClIN4O2 |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-(1-cyclopropylpyrrolidin-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Cl)c2c(c1)OCCCO2)NC1CCN(C2CC2)C1.I |
| InChI | InChI=1S/C20H29ClN4O2.HI/c1-2-22-20(24-15-6-7-25(13-15)16-4-5-16)23-12-14-10-17(21)19-18(11-14)26-8-3-9-27-19;/h10-11,15-16H,2-9,12-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | SEPUFMLHGBPFBT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|