C20H30FN3O2 — CID 111255619
1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(4-methylcyclohexyl)guanidine (PubChem CID 111255619) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(4-methylcyclohexyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(4-methylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 111255619 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(4-methylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\CCc1cc(F)cc2c1OCOC2)NC1CCC(C)CC1 |
| InChI | InChI=1S/C20H30FN3O2/c1-3-22-20(24-18-6-4-14(2)5-7-18)23-9-8-15-10-17(21)11-16-12-25-13-26-19(15)16/h10-11,14,18H,3-9,12-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | PBCGWTZSWWNGJN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|