C17H27FIN3O3 — CID 75371558
1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(1-methoxypropan-2-yl)guanidine;hydroiodide (PubChem CID 75371558) has the molecular formula C17H27FIN3O3 and a molecular weight of 467.32 g/mol. Its IUPAC name is 1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(1-methoxypropan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(1-methoxypropan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 75371558 |
| Molecular Formula | C17H27FIN3O3 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cc(F)cc2c1OCOC2)NC(C)COC.I |
| InChI | InChI=1S/C17H26FN3O3.HI/c1-4-19-17(21-12(2)9-22-3)20-6-5-13-7-15(18)8-14-10-23-11-24-16(13)14;/h7-8,12H,4-6,9-11H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | GBPMJBQDTDHGPZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|