C23H27F2IN4O2 — CID 111888588
1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111888588) has the molecular formula C23H27F2IN4O2 and a molecular weight of 556.40 g/mol. Its IUPAC name is 1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888588 |
| Molecular Formula | C23H27F2IN4O2 |
| Molecular Weight | 556.40 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | 1-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cc(F)cc2c1OCOC2)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C23H26F2N4O2.HI/c1-2-26-23(28-8-6-16-12-29-21-11-18(24)3-4-20(16)21)27-7-5-15-9-19(25)10-17-13-30-14-31-22(15)17;/h3-4,9-12,29H,2,5-8,13-14H2,1H3,(H2,26,27,28);1H |
| InChIKey | LSULTTAQTOPFRM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|