C19H22ClFIN3O2 — CID 119130526
1-[(2-chlorophenyl)methyl]-3-ethyl-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide (PubChem CID 119130526) has the molecular formula C19H22ClFIN3O2 and a molecular weight of 505.76 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-ethyl-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119130526 |
| Molecular Formula | C19H22ClFIN3O2 |
| Molecular Weight | 505.76 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)cc2c1OCOC2)NCc1ccccc1Cl.I |
| InChI | InChI=1S/C19H21ClFN3O2.HI/c1-2-22-19(23-9-13-5-3-4-6-17(13)20)24-10-14-7-16(21)8-15-11-25-12-26-18(14)15;/h3-8H,2,9-12H2,1H3,(H2,22,23,24);1H |
| InChIKey | GKFFZSWPXQAUAY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|