C23H26FN3O3 — CID 111603217
1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine (PubChem CID 111603217) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111603217 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1oc2ccccc2c1C)NCCc1cc(F)cc2c1OCOC2 |
| InChI | InChI=1S/C23H26FN3O3/c1-3-25-23(27-12-21-15(2)19-6-4-5-7-20(19)30-21)26-9-8-16-10-18(24)11-17-13-28-14-29-22(16)17/h4-7,10-11H,3,8-9,12-14H2,1-2H3,(H2,25,26,27) |
| InChIKey | RQXBVHOZRBHWJZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|