C21H29FN4O3 — CID 111594050
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]guanidine (PubChem CID 111594050) has the molecular formula C21H29FN4O3 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]guanidine.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111594050 |
| Molecular Formula | C21H29FN4O3 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCCc1cc(F)cc2c1OCOC2 |
| InChI | InChI=1S/C21H29FN4O3/c1-5-23-20(26-11-18-25-10-17(29-18)21(2,3)4)24-7-6-14-8-16(22)9-15-12-27-13-28-19(14)15/h8-10H,5-7,11-13H2,1-4H3,(H2,23,24,26) |
| InChIKey | MTLWRXVQSMVFIV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|