C22H29FIN3O3 — CID 109409436
1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 109409436) has the molecular formula C22H29FIN3O3 and a molecular weight of 529.39 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109409436 |
| Molecular Formula | C22H29FIN3O3 |
| Molecular Weight | 529.39 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CO)c1ccccc1)NCCc1cc(F)cc2c1OCOC2.I |
| InChI | InChI=1S/C22H28FN3O3.HI/c1-2-24-22(26-12-19(13-27)16-6-4-3-5-7-16)25-9-8-17-10-20(23)11-18-14-28-15-29-21(17)18;/h3-7,10-11,19,27H,2,8-9,12-15H2,1H3,(H2,24,25,26);1H |
| InChIKey | ODEIRYZOEVCDFS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|