C15H21FIN3O2 — CID 119121390
1-(cyclobutylmethyl)-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide (PubChem CID 119121390) has the molecular formula C15H21FIN3O2 and a molecular weight of 421.25 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclobutylmethyl)-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119121390 |
| Molecular Formula | C15H21FIN3O2 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cc(F)cc2c1OCOC2)NCC1CCC1 |
| InChI | InChI=1S/C15H20FN3O2.HI/c16-13-4-11(14-12(5-13)8-20-9-21-14)7-19-15(17)18-6-10-2-1-3-10;/h4-5,10H,1-3,6-9H2,(H3,17,18,19);1H |
| InChIKey | KLUADJICVCLKKA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|