C16H24IN5S — CID 111098814
2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111098814) has the molecular formula C16H24IN5S and a molecular weight of 445.37 g/mol. Its IUPAC name is 2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111098814 |
| Molecular Formula | C16H24IN5S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | Cc1csc(CCCC/N=C(\N)NCCc2ccccn2)n1.I |
| InChI | InChI=1S/C16H23N5S.HI/c1-13-12-22-15(21-13)7-3-5-10-19-16(17)20-11-8-14-6-2-4-9-18-14;/h2,4,6,9,12H,3,5,7-8,10-11H2,1H3,(H3,17,19,20);1H |
| InChIKey | TZDIUSZROGGGNW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|