C12H19IN6S — CID 111065921
2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111065921) has the molecular formula C12H19IN6S and a molecular weight of 406.30 g/mol. Its IUPAC name is 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111065921 |
| Molecular Formula | C12H19IN6S |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCn1cnnc1C/N=C(\N)NCCc1cccs1.I |
| InChI | InChI=1S/C12H18N6S.HI/c1-2-18-9-16-17-11(18)8-15-12(13)14-6-5-10-4-3-7-19-10;/h3-4,7,9H,2,5-6,8H2,1H3,(H3,13,14,15);1H |
| InChIKey | VTNIROMHJIBWEN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|