C16H25IN4OS — CID 111820141
2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111820141) has the molecular formula C16H25IN4OS and a molecular weight of 448.37 g/mol. Its IUPAC name is 2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111820141 |
| Molecular Formula | C16H25IN4OS |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCC(CC)c1cc(C/N=C(\N)NCCc2cccs2)on1.I |
| InChI | InChI=1S/C16H24N4OS.HI/c1-3-12(4-2)15-10-13(21-20-15)11-19-16(17)18-8-7-14-6-5-9-22-14;/h5-6,9-10,12H,3-4,7-8,11H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | ANLDIIUKEQPUSX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|