C18H27IN4O3 — CID 111813613
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111813613) has the molecular formula C18H27IN4O3 and a molecular weight of 474.34 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111813613 |
| Molecular Formula | C18H27IN4O3 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/Cc2cc(C(C)C)no2)cc1OC.I |
| InChI | InChI=1S/C18H26N4O3.HI/c1-12(2)15-10-14(25-22-15)11-21-18(19)20-8-7-13-5-6-16(23-3)17(9-13)24-4;/h5-6,9-10,12H,7-8,11H2,1-4H3,(H3,19,20,21);1H |
| InChIKey | QFDHWGCEXHLZFM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|