C16H24N4O2S — CID 71865317
1-(2-methoxyethyl)-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 71865317) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-(2-methoxyethyl)-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 71865317 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-(2-methoxyethyl)-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | COCCN/C(=N\Cc1cc(C(C)C)no1)NCc1cccs1 |
| InChI | InChI=1S/C16H24N4O2S/c1-12(2)15-9-13(22-20-15)10-18-16(17-6-7-21-3)19-11-14-5-4-8-23-14/h4-5,8-9,12H,6-7,10-11H2,1-3H3,(H2,17,18,19) |
| InChIKey | NTXPSXIXVCBOKW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|