C15H22N4O2S — CID 75364706
1-(3-methoxypropyl)-2-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 75364706) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-(3-methoxypropyl)-2-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 75364706 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-(3-methoxypropyl)-2-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | COCCCN/C(=N\Cc1cc(C)no1)NCc1cccs1 |
| InChI | InChI=1S/C15H22N4O2S/c1-12-9-13(21-19-12)10-17-15(16-6-4-7-20-2)18-11-14-5-3-8-22-14/h3,5,8-9H,4,6-7,10-11H2,1-2H3,(H2,16,17,18) |
| InChIKey | MJGJKHWJWNKDJG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|