C17H21IN6O — CID 111015646
1-[2-(furan-2-yl)ethyl]-3-prop-2-enyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015646) has the molecular formula C17H21IN6O and a molecular weight of 452.30 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-prop-2-enyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-prop-2-enyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015646 |
| Molecular Formula | C17H21IN6O |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-prop-2-enyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1nnc2ccccn12)NCCc1ccco1.I |
| InChI | InChI=1S/C17H20N6O.HI/c1-2-9-18-17(19-10-8-14-6-5-12-24-14)20-13-16-22-21-15-7-3-4-11-23(15)16;/h2-7,11-12H,1,8-10,13H2,(H2,18,19,20);1H |
| InChIKey | BSDISVCNRWZLGH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|