C17H25N7O — CID 111014881
1-ethyl-3-[3-(2-oxopyrrolidin-1-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111014881) has the molecular formula C17H25N7O and a molecular weight of 343.44 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-oxopyrrolidin-1-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(2-oxopyrrolidin-1-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111014881 |
| Molecular Formula | C17H25N7O |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-ethyl-3-[3-(2-oxopyrrolidin-1-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCCN1CCCC1=O |
| InChI | InChI=1S/C17H25N7O/c1-2-18-17(19-9-6-11-23-10-5-8-16(23)25)20-13-15-22-21-14-7-3-4-12-24(14)15/h3-4,7,12H,2,5-6,8-11,13H2,1H3,(H2,18,19,20) |
| InChIKey | YJBGSRKSWAZFJC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|